C10H17NO — CID 145352645
N,N-dimethyl-1-(5-methylfuran-2-yl)propan-1-amine (PubChem CID 145352645) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is N,N-dimethyl-1-(5-methylfuran-2-yl)propan-1-amine.
| Compound Name | N,N-dimethyl-1-(5-methylfuran-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 145352645 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N,N-dimethyl-1-(5-methylfuran-2-yl)propan-1-amine |
| SMILES | CCC(c1ccc(C)o1)N(C)C |
| InChI | InChI=1S/C10H17NO/c1-5-9(11(3)4)10-7-6-8(2)12-10/h6-7,9H,5H2,1-4H3 |
| InChIKey | KPSLAGYUXRSICN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |