C9H14ClNO — CID 116907489
2-chloro-N,N-dimethyl-1-(5-methylfuran-2-yl)ethanamine (PubChem CID 116907489) has the molecular formula C9H14ClNO and a molecular weight of 187.67 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-1-(5-methylfuran-2-yl)ethanamine.
| Compound Name | 2-chloro-N,N-dimethyl-1-(5-methylfuran-2-yl)ethanamine |
|---|---|
| PubChem CID | 116907489 |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-chloro-N,N-dimethyl-1-(5-methylfuran-2-yl)ethanamine |
| SMILES | Cc1ccc(C(CCl)N(C)C)o1 |
| InChI | InChI=1S/C9H14ClNO/c1-7-4-5-9(12-7)8(6-10)11(2)3/h4-5,8H,6H2,1-3H3 |
| InChIKey | APISIPSTCWFFCE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|