C16H19FN2O2 — CID 26834409
N-[(2S)-2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]-4-fluorobenzamide (PubChem CID 26834409) has the molecular formula C16H19FN2O2 and a molecular weight of 290.34 g/mol. Its IUPAC name is N-[(2S)-2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]-4-fluorobenzamide.
| Compound Name | N-[(2S)-2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 26834409 |
| Molecular Formula | C16H19FN2O2 |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-[(2S)-2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]-4-fluorobenzamide |
| SMILES | Cc1ccc([C@H](CNC(=O)c2ccc(F)cc2)N(C)C)o1 |
| InChI | InChI=1S/C16H19FN2O2/c1-11-4-9-15(21-11)14(19(2)3)10-18-16(20)12-5-7-13(17)8-6-12/h4-9,14H,10H2,1-3H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | UNDQXBDEFAEOTH-AWEZNQCLSA-N |
| XLogP | 2.76 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |