C17H21ClN2O3 — CID 26834913
3-chloro-N-[(2R)-2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]-4-methoxybenzamide (PubChem CID 26834913) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is 3-chloro-N-[(2R)-2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]-4-methoxybenzamide.
| Compound Name | 3-chloro-N-[(2R)-2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 26834913 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 3-chloro-N-[(2R)-2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC[C@H](c2ccc(C)o2)N(C)C)cc1Cl |
| InChI | InChI=1S/C17H21ClN2O3/c1-11-5-7-16(23-11)14(20(2)3)10-19-17(21)12-6-8-15(22-4)13(18)9-12/h5-9,14H,10H2,1-4H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | NEIUXXKTHQMLKP-CQSZACIVSA-N |
| XLogP | 3.28 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |