C14H19ClN2O3 — CID 146052539
N-[2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]furan-2-carboxamide;hydrochloride (PubChem CID 146052539) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]furan-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 146052539 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-[2-(dimethylamino)-2-(5-methylfuran-2-yl)ethyl]furan-2-carboxamide;hydrochloride |
| SMILES | Cc1ccc(C(CNC(=O)c2ccco2)N(C)C)o1.Cl |
| InChI | InChI=1S/C14H18N2O3.ClH/c1-10-6-7-12(19-10)11(16(2)3)9-15-14(17)13-5-4-8-18-13;/h4-8,11H,9H2,1-3H3,(H,15,17);1H |
| InChIKey | RVTMKBLNLYWBJG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |