C9H19N3O3 — CID 83019637
3-(dimethylaminocarbamoylamino)-4-methylpentanoic acid (PubChem CID 83019637) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-(dimethylaminocarbamoylamino)-4-methylpentanoic acid.
| Compound Name | 3-(dimethylaminocarbamoylamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 83019637 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 3-(dimethylaminocarbamoylamino)-4-methylpentanoic acid |
| SMILES | CC(C)C(CC(=O)O)NC(=O)NN(C)C |
| InChI | InChI=1S/C9H19N3O3/c1-6(2)7(5-8(13)14)10-9(15)11-12(3)4/h6-7H,5H2,1-4H3,(H,13,14)(H2,10,11,15) |
| InChIKey | SGKUKRTYPZNKTJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|