About (3R)-4,4-dimethyl-3-(methylamino)pentanoic acid;hydrochloride
(3R)-4,4-dimethyl-3-(methylamino)pentanoic acid;hydrochloride (PubChem CID 170900105) has the molecular formula C8H18ClNO2
and a molecular weight of 195.69 g/mol. Its IUPAC name is (3R)-4,4-dimethyl-3-(methylamino)pentanoic acid;hydrochloride.
Analyze (3R)-4,4-dimethyl-3-(methylamino)pentanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4,4-dimethyl-3-(methylamino)pentanoic acid;hydrochloride?
The IUPAC name of (3R)-4,4-dimethyl-3-(methylamino)pentanoic acid;hydrochloride (CID 170900105) is (3R)-4,4-dimethyl-3-(methylamino)pentanoic acid;hydrochloride.
What is the SMILES notation for (3R)-4,4-dimethyl-3-(methylamino)pentanoic acid;hydrochloride?
The canonical SMILES for (3R)-4,4-dimethyl-3-(methylamino)pentanoic acid;hydrochloride is CN[C@H](CC(=O)O)C(C)(C)C.Cl.
What is the InChIKey of (3R)-4,4-dimethyl-3-(methylamino)pentanoic acid;hydrochloride?
The InChIKey is VOWYLKCEBOUMCF-FYZOBXCZSA-N. The full InChI is InChI=1S/C8H17NO2.ClH/c1-8(2,3)6(9-4)5-7(10)11;/h6,9H,5H2,1-4H3,(H,10,11);1H/t6-;/m1./s1.
What are the key properties of (3R)-4,4-dimethyl-3-(methylamino)pentanoic acid;hydrochloride?
(3R)-4,4-dimethyl-3-(methylamino)pentanoic acid;hydrochloride has a molecular weight of 195.69 g/mol, XLogP of 1.52, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4,4-dimethyl-3-(methylamino)pentanoic acid;hydrochloride is sourced from PubChem (CID 170900105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).