About N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide
N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide (PubChem CID 89050454) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide.
Molecular Properties
| Compound Name | N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide |
| PubChem CID | 89050454 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide |
| SMILES | CN[C@H](CN(C)C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C10H22N2O/c1-8(13)12(6)7-9(11-5)10(2,3)4/h9,11H,7H2,1-6H3/t9-/m1/s1 |
| InChIKey | QRUKXHYWADEZPM-SECBINFHSA-N |
| XLogP | 1.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide?
The IUPAC name of N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide (CID 89050454) is N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide.
What is the SMILES notation for N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide?
The canonical SMILES for N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide is CN[C@H](CN(C)C(C)=O)C(C)(C)C.
What is the InChIKey of N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide?
The InChIKey is QRUKXHYWADEZPM-SECBINFHSA-N. The full InChI is InChI=1S/C10H22N2O/c1-8(13)12(6)7-9(11-5)10(2,3)4/h9,11H,7H2,1-6H3/t9-/m1/s1.
What are the key properties of N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide?
N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide has a molecular weight of 186.30 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-3,3-dimethyl-2-(methylamino)butyl]-N-methylacetamide is sourced from PubChem (CID 89050454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).