C17H36N2O2 — CID 143105338
N-[3,3-dimethyl-2-(methylamino)butyl]-N,3,3-trimethyl-5-oxopentanamide;ethane (PubChem CID 143105338) has the molecular formula C17H36N2O2 and a molecular weight of 300.49 g/mol. Its IUPAC name is N-[3,3-dimethyl-2-(methylamino)butyl]-N,3,3-trimethyl-5-oxopentanamide;ethane.
| Compound Name | N-[3,3-dimethyl-2-(methylamino)butyl]-N,3,3-trimethyl-5-oxopentanamide;ethane |
|---|---|
| PubChem CID | 143105338 |
| Molecular Formula | C17H36N2O2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | N-[3,3-dimethyl-2-(methylamino)butyl]-N,3,3-trimethyl-5-oxopentanamide;ethane |
| SMILES | CC.CNC(CN(C)C(=O)CC(C)(C)CC=O)C(C)(C)C |
| InChI | InChI=1S/C15H30N2O2.C2H6/c1-14(2,3)12(16-6)11-17(7)13(19)10-15(4,5)8-9-18;1-2/h9,12,16H,8,10-11H2,1-7H3;1-2H3 |
| InChIKey | YDILGMCSFOWJSF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|