C11H24N2O — CID 115157243
4-amino-N,3,3-trimethyl-N-(2-methylpropyl)butanamide (PubChem CID 115157243) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 4-amino-N,3,3-trimethyl-N-(2-methylpropyl)butanamide.
| Compound Name | 4-amino-N,3,3-trimethyl-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 115157243 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 4-amino-N,3,3-trimethyl-N-(2-methylpropyl)butanamide |
| SMILES | CC(C)CN(C)C(=O)CC(C)(C)CN |
| InChI | InChI=1S/C11H24N2O/c1-9(2)7-13(5)10(14)6-11(3,4)8-12/h9H,6-8,12H2,1-5H3 |
| InChIKey | ZAMNHUFROVYABC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |