C14H36N2S — CID 143141924
ethane;1-N-ethyl-2-N,3,3-trimethyl-1-N-methylsulfanylbutane-1,2-diamine (PubChem CID 143141924) has the molecular formula C14H36N2S and a molecular weight of 264.52 g/mol. Its IUPAC name is ethane;1-N-ethyl-2-N,3,3-trimethyl-1-N-methylsulfanylbutane-1,2-diamine.
| Compound Name | ethane;1-N-ethyl-2-N,3,3-trimethyl-1-N-methylsulfanylbutane-1,2-diamine |
|---|---|
| PubChem CID | 143141924 |
| Molecular Formula | C14H36N2S |
| Molecular Weight | 264.52 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | ethane;1-N-ethyl-2-N,3,3-trimethyl-1-N-methylsulfanylbutane-1,2-diamine |
| SMILES | CC.CC.CCN(CC(NC)C(C)(C)C)SC |
| InChI | InChI=1S/C10H24N2S.2C2H6/c1-7-12(13-6)8-9(11-5)10(2,3)4;2*1-2/h9,11H,7-8H2,1-6H3;2*1-2H3 |
| InChIKey | DFPGVROTCQXZIS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|