3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid

C11H17NO3 — CID 107986943

IUPAC3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid
SMILESCC#CC(=O)NC(CC(=O)O)C(C)(C)C
InChIInChI=1S/C11H17NO3/c1-5-6-9(13)12-8(7-10(14)15)11(2,3)4/h8H,7H2,1-4H3,(H,12,13)(H,14,15)
InChIKeyUXQYLMIQRDLVIU-UHFFFAOYSA-N
MW211.26 g/mol
LogP1.02
Rot. Bonds3

About 3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid

3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid (PubChem CID 107986943) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid.

Molecular Properties

Compound Name3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid
PubChem CID107986943
Molecular FormulaC11H17NO3
Molecular Weight211.26 g/mol
Exact Mass211.12
IUPAC Name3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid
SMILESCC#CC(=O)NC(CC(=O)O)C(C)(C)C
InChIInChI=1S/C11H17NO3/c1-5-6-9(13)12-8(7-10(14)15)11(2,3)4/h8H,7H2,1-4H3,(H,12,13)(H,14,15)
InChIKeyUXQYLMIQRDLVIU-UHFFFAOYSA-N
XLogP1.02
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.26
LogP ≤ 51.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid?
The IUPAC name of 3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid (CID 107986943) is 3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid.
What is the SMILES notation for 3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid?
The canonical SMILES for 3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid is CC#CC(=O)NC(CC(=O)O)C(C)(C)C.
What is the InChIKey of 3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid?
The InChIKey is UXQYLMIQRDLVIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c1-5-6-9(13)12-8(7-10(14)15)11(2,3)4/h8H,7H2,1-4H3,(H,12,13)(H,14,15).
What are the key properties of 3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid?
3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid has a molecular weight of 211.26 g/mol, XLogP of 1.02, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(but-2-ynoylamino)-4,4-dimethylpentanoic acid is sourced from PubChem (CID 107986943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).