C9H17NO3 — CID 147876224
4,4-dimethyl-3-(methylcarbamoyl)pentanoic acid (PubChem CID 147876224) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 4,4-dimethyl-3-(methylcarbamoyl)pentanoic acid.
| Compound Name | 4,4-dimethyl-3-(methylcarbamoyl)pentanoic acid |
|---|---|
| PubChem CID | 147876224 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 4,4-dimethyl-3-(methylcarbamoyl)pentanoic acid |
| SMILES | CNC(=O)C(CC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C9H17NO3/c1-9(2,3)6(5-7(11)12)8(13)10-4/h6H,5H2,1-4H3,(H,10,13)(H,11,12) |
| InChIKey | HZOOPQZXANKARK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |