C8H10O8 — CID 101279085
1-methylpropane-1,1,2,3-tetracarboxylic acid (PubChem CID 101279085) has the molecular formula C8H10O8 and a molecular weight of 234.16 g/mol. Its IUPAC name is 1-methylpropane-1,1,2,3-tetracarboxylic acid.
| Compound Name | 1-methylpropane-1,1,2,3-tetracarboxylic acid |
|---|---|
| PubChem CID | 101279085 |
| Molecular Formula | C8H10O8 |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 1-methylpropane-1,1,2,3-tetracarboxylic acid |
| SMILES | CC(C(=O)O)(C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H10O8/c1-8(6(13)14,7(15)16)3(5(11)12)2-4(9)10/h3H,2H2,1H3,(H,9,10)(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | CMISLPUNVPMSLJ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|