C7H11NaO7 — CID 175068957
sodium;hydride;3-hydroxybutane-1,2,3-tricarboxylic acid (PubChem CID 175068957) has the molecular formula C7H11NaO7 and a molecular weight of 230.15 g/mol. Its IUPAC name is sodium;hydride;3-hydroxybutane-1,2,3-tricarboxylic acid.
| Compound Name | sodium;hydride;3-hydroxybutane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 175068957 |
| Molecular Formula | C7H11NaO7 |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | sodium;hydride;3-hydroxybutane-1,2,3-tricarboxylic acid |
| SMILES | CC(O)(C(=O)O)C(CC(=O)O)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C7H10O7.Na.H/c1-7(14,6(12)13)3(5(10)11)2-4(8)9;;/h3,14H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13);;/q;+1;-1 |
| InChIKey | FMSRLIUCPJLIFN-UHFFFAOYSA-N |
| XLogP | -3.89 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |