C5H8INO3S — CID 134572230
3-iodosulfanyl-4-(methylamino)-4-oxobutanoic acid (PubChem CID 134572230) has the molecular formula C5H8INO3S and a molecular weight of 289.09 g/mol. Its IUPAC name is 3-iodosulfanyl-4-(methylamino)-4-oxobutanoic acid.
| Compound Name | 3-iodosulfanyl-4-(methylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 134572230 |
| Molecular Formula | C5H8INO3S |
| Molecular Weight | 289.09 g/mol |
| Exact Mass | 288.93 |
| IUPAC Name | 3-iodosulfanyl-4-(methylamino)-4-oxobutanoic acid |
| SMILES | CNC(=O)C(CC(=O)O)SI |
| InChI | InChI=1S/C5H8INO3S/c1-7-5(10)3(11-6)2-4(8)9/h3H,2H2,1H3,(H,7,10)(H,8,9) |
| InChIKey | FVCJFOPALXBUKE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.09 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|