C13H27N3O4S — CID 145098343
3-[[3-amino-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-4-methyl-4-sulfanylpentanoic acid;ethane (PubChem CID 145098343) has the molecular formula C13H27N3O4S and a molecular weight of 321.44 g/mol. Its IUPAC name is 3-[[3-amino-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-4-methyl-4-sulfanylpentanoic acid;ethane.
| Compound Name | 3-[[3-amino-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-4-methyl-4-sulfanylpentanoic acid;ethane |
|---|---|
| PubChem CID | 145098343 |
| Molecular Formula | C13H27N3O4S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 3-[[3-amino-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-4-methyl-4-sulfanylpentanoic acid;ethane |
| SMILES | CC.CNC(=O)C(CN)NC(=O)C(CC(=O)O)C(C)(C)S |
| InChI | InChI=1S/C11H21N3O4S.C2H6/c1-11(2,19)6(4-8(15)16)9(17)14-7(5-12)10(18)13-3;1-2/h6-7,19H,4-5,12H2,1-3H3,(H,13,18)(H,14,17)(H,15,16);1-2H3 |
| InChIKey | XNJIXSMAIBBXHU-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|