C11H18N2O6S — CID 71459508
(4S)-4-[[2-(carboxymethyl)-3-sulfanylpropanoyl]amino]-5-(methylamino)-5-oxopentanoic acid (PubChem CID 71459508) has the molecular formula C11H18N2O6S and a molecular weight of 306.34 g/mol. Its IUPAC name is (4S)-4-[[2-(carboxymethyl)-3-sulfanylpropanoyl]amino]-5-(methylamino)-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[2-(carboxymethyl)-3-sulfanylpropanoyl]amino]-5-(methylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 71459508 |
| Molecular Formula | C11H18N2O6S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (4S)-4-[[2-(carboxymethyl)-3-sulfanylpropanoyl]amino]-5-(methylamino)-5-oxopentanoic acid |
| SMILES | CNC(=O)[C@H](CCC(=O)O)NC(=O)C(CS)CC(=O)O |
| InChI | InChI=1S/C11H18N2O6S/c1-12-11(19)7(2-3-8(14)15)13-10(18)6(5-20)4-9(16)17/h6-7,20H,2-5H2,1H3,(H,12,19)(H,13,18)(H,14,15)(H,16,17)/t6?,7-/m0/s1 |
| InChIKey | SLHBJWAKFWGTGR-MLWJPKLSSA-N |
| XLogP | -0.90 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|