C16H28N2O6 — CID 163744239
3-[[4-carboxy-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]nonanoic acid (PubChem CID 163744239) has the molecular formula C16H28N2O6 and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-[[4-carboxy-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]nonanoic acid.
| Compound Name | 3-[[4-carboxy-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]nonanoic acid |
|---|---|
| PubChem CID | 163744239 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 3-[[4-carboxy-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]nonanoic acid |
| SMILES | CCCCCCC(CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC |
| InChI | InChI=1S/C16H28N2O6/c1-3-4-5-6-7-11(10-14(21)22)15(23)18-12(16(24)17-2)8-9-13(19)20/h11-12H,3-10H2,1-2H3,(H,17,24)(H,18,23)(H,19,20)(H,21,22) |
| InChIKey | LKLAWBRMPQWPAZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|