C17H32N2O3 — CID 71315130
(E,3S,7R,8R)-6-(dimethylamino)-7-hydroxy-2,8-dimethyl-3-(methylamino)dodec-10-ene-4,5-dione (PubChem CID 71315130) has the molecular formula C17H32N2O3 and a molecular weight of 312.45 g/mol. Its IUPAC name is (E,3S,7R,8R)-6-(dimethylamino)-7-hydroxy-2,8-dimethyl-3-(methylamino)dodec-10-ene-4,5-dione.
| Compound Name | (E,3S,7R,8R)-6-(dimethylamino)-7-hydroxy-2,8-dimethyl-3-(methylamino)dodec-10-ene-4,5-dione |
|---|---|
| PubChem CID | 71315130 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | (E,3S,7R,8R)-6-(dimethylamino)-7-hydroxy-2,8-dimethyl-3-(methylamino)dodec-10-ene-4,5-dione |
| SMILES | C/C=C/C[C@@H](C)[C@@H](O)C(C(=O)C(=O)[C@@H](NC)C(C)C)N(C)C |
| InChI | InChI=1S/C17H32N2O3/c1-8-9-10-12(4)15(20)14(19(6)7)17(22)16(21)13(18-5)11(2)3/h8-9,11-15,18,20H,10H2,1-7H3/b9-8+/t12-,13+,14?,15-/m1/s1 |
| InChIKey | NEIFYFOCFQBPTE-RMUVANJPSA-N |
| XLogP | 1.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|