C14H25NO2 — CID 90846585
(3S,5R)-11,11,11-trideuterio-3-(dimethylamino)-4-hydroxy-5-methylundeca-7,9-dien-2-one (PubChem CID 90846585) has the molecular formula C14H25NO2 and a molecular weight of 242.38 g/mol. Its IUPAC name is (3S,5R)-11,11,11-trideuterio-3-(dimethylamino)-4-hydroxy-5-methylundeca-7,9-dien-2-one.
| Compound Name | (3S,5R)-11,11,11-trideuterio-3-(dimethylamino)-4-hydroxy-5-methylundeca-7,9-dien-2-one |
|---|---|
| PubChem CID | 90846585 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | (3S,5R)-11,11,11-trideuterio-3-(dimethylamino)-4-hydroxy-5-methylundeca-7,9-dien-2-one |
| SMILES | [2H]C([2H])([2H])C=CC=CC[C@@H](C)C(O)[C@@H](C(C)=O)N(C)C |
| InChI | InChI=1S/C14H25NO2/c1-6-7-8-9-10-11(2)14(17)13(12(3)16)15(4)5/h6-9,11,13-14,17H,10H2,1-5H3/t11-,13-,14?/m1/s1/i1D3 |
| InChIKey | FZZPIOMMMCETQE-JAQTXGRQSA-N |
| XLogP | 2.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|