C21H41NO — CID 59857863
(4R,5R,7E,9E)-3-[tert-butyl(methyl)amino]-2,2,5-trimethyltrideca-7,9-dien-4-ol (PubChem CID 59857863) has the molecular formula C21H41NO and a molecular weight of 323.57 g/mol. Its IUPAC name is (4R,5R,7E,9E)-3-[tert-butyl(methyl)amino]-2,2,5-trimethyltrideca-7,9-dien-4-ol.
| Compound Name | (4R,5R,7E,9E)-3-[tert-butyl(methyl)amino]-2,2,5-trimethyltrideca-7,9-dien-4-ol |
|---|---|
| PubChem CID | 59857863 |
| Molecular Formula | C21H41NO |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 323.32 |
| IUPAC Name | (4R,5R,7E,9E)-3-[tert-butyl(methyl)amino]-2,2,5-trimethyltrideca-7,9-dien-4-ol |
| SMILES | CCC/C=C/C=C/C[C@@H](C)[C@@H](O)C(N(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H41NO/c1-10-11-12-13-14-15-16-17(2)18(23)19(20(3,4)5)22(9)21(6,7)8/h12-15,17-19,23H,10-11,16H2,1-9H3/b13-12+,15-14+/t17-,18-,19?/m1/s1 |
| InChIKey | VWVYOVWYRBAVKJ-PGRKOLTISA-N |
| XLogP | 5.43 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|