C12H20 — CID 56999548
3-methylundeca-2,5,7-triene (PubChem CID 56999548) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 3-methylundeca-2,5,7-triene.
| Compound Name | 3-methylundeca-2,5,7-triene |
|---|---|
| PubChem CID | 56999548 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 3-methylundeca-2,5,7-triene |
| SMILES | CC=C(C)CC=CC=CCCC |
| InChI | InChI=1S/C12H20/c1-4-6-7-8-9-10-11-12(3)5-2/h5,7-10H,4,6,11H2,1-3H3 |
| InChIKey | FPAKXIJNIFWYJN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|