About hepta-1,3-dienylboronic acid
hepta-1,3-dienylboronic acid (PubChem CID 85176249) has the molecular formula C7H13BO2
and a molecular weight of 139.99 g/mol. Its IUPAC name is hepta-1,3-dienylboronic acid.
Molecular Properties
| Compound Name | hepta-1,3-dienylboronic acid |
| PubChem CID | 85176249 |
| Molecular Formula | C7H13BO2 |
| Molecular Weight | 139.99 g/mol |
| Exact Mass | 140.10 |
| IUPAC Name | hepta-1,3-dienylboronic acid |
| SMILES | CCCC=CC=CB(O)O |
| InChI | InChI=1S/C7H13BO2/c1-2-3-4-5-6-7-8(9)10/h4-7,9-10H,2-3H2,1H3 |
| InChIKey | RAELEJPKRSRLHL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.99 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze hepta-1,3-dienylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hepta-1,3-dienylboronic acid?
The IUPAC name of hepta-1,3-dienylboronic acid (CID 85176249) is hepta-1,3-dienylboronic acid.
What is the SMILES notation for hepta-1,3-dienylboronic acid?
The canonical SMILES for hepta-1,3-dienylboronic acid is CCCC=CC=CB(O)O.
What is the InChIKey of hepta-1,3-dienylboronic acid?
The InChIKey is RAELEJPKRSRLHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13BO2/c1-2-3-4-5-6-7-8(9)10/h4-7,9-10H,2-3H2,1H3.
What are the key properties of hepta-1,3-dienylboronic acid?
hepta-1,3-dienylboronic acid has a molecular weight of 139.99 g/mol, XLogP of 0.91, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hepta-1,3-dienylboronic acid is sourced from PubChem (CID 85176249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).