C14H24NP — CID 123708814
1-ethylidenephosphanyl-N-propylnona-3,5-dien-1-imine (PubChem CID 123708814) has the molecular formula C14H24NP and a molecular weight of 237.33 g/mol. Its IUPAC name is 1-ethylidenephosphanyl-N-propylnona-3,5-dien-1-imine.
| Compound Name | 1-ethylidenephosphanyl-N-propylnona-3,5-dien-1-imine |
|---|---|
| PubChem CID | 123708814 |
| Molecular Formula | C14H24NP |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 1-ethylidenephosphanyl-N-propylnona-3,5-dien-1-imine |
| SMILES | C/C=P/C(CC=CC=CCCC)=N\CCC |
| InChI | InChI=1S/C14H24NP/c1-4-7-8-9-10-11-12-14(16-6-3)15-13-5-2/h6,8-11H,4-5,7,12-13H2,1-3H3/b9-8?,11-10?,15-14- |
| InChIKey | WNHIPRRIIDKCJG-VLMPBRHTSA-N |
| XLogP | 4.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|