C16H35NO2 — CID 158517713
ethane;(3S,5R)-8,9,9,9-tetradeuterio-3-(dimethylamino)-4-hydroxy-5-methylnon-7-en-2-one (PubChem CID 158517713) has the molecular formula C16H35NO2 and a molecular weight of 277.49 g/mol. Its IUPAC name is ethane;(3S,5R)-8,9,9,9-tetradeuterio-3-(dimethylamino)-4-hydroxy-5-methylnon-7-en-2-one.
| Compound Name | ethane;(3S,5R)-8,9,9,9-tetradeuterio-3-(dimethylamino)-4-hydroxy-5-methylnon-7-en-2-one |
|---|---|
| PubChem CID | 158517713 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 277.49 g/mol |
| Exact Mass | 277.29 |
| IUPAC Name | ethane;(3S,5R)-8,9,9,9-tetradeuterio-3-(dimethylamino)-4-hydroxy-5-methylnon-7-en-2-one |
| SMILES | CC.CC.[2H]C(=CC[C@@H](C)C(O)[C@@H](C(C)=O)N(C)C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C12H23NO2.2C2H6/c1-6-7-8-9(2)12(15)11(10(3)14)13(4)5;2*1-2/h6-7,9,11-12,15H,8H2,1-5H3;2*1-2H3/t9-,11-,12?;;/m1../s1/i1D3,6D;; |
| InChIKey | HLVHTFNVBGPOGF-MNUWPWPRSA-N |
| XLogP | 3.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|