C26H47N3O5 — CID 71315114
[(E,6R)-9,10,10,10-tetradeuterio-6-methyl-4-[methyl-[(2S)-3-methyl-2-[[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoyl]amino]-3-oxo(9,10-13C2)dec-8-en-5-yl] acetate (PubChem CID 71315114) has the molecular formula C26H47N3O5 and a molecular weight of 487.69 g/mol. Its IUPAC name is [(E,6R)-9,10,10,10-tetradeuterio-6-methyl-4-[methyl-[(2S)-3-methyl-2-[[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoyl]amino]-3-oxo(9,10-13C2)dec-8-en-5-yl] acetate.
| Compound Name | [(E,6R)-9,10,10,10-tetradeuterio-6-methyl-4-[methyl-[(2S)-3-methyl-2-[[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoyl]amino]-3-oxo(9,10-13C2)dec-8-en-5-yl] acetate |
|---|---|
| PubChem CID | 71315114 |
| Molecular Formula | C26H47N3O5 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.38 |
| IUPAC Name | [(E,6R)-9,10,10,10-tetradeuterio-6-methyl-4-[methyl-[(2S)-3-methyl-2-[[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoyl]amino]-3-oxo(9,10-13C2)dec-8-en-5-yl] acetate |
| SMILES | [2H]/[13C](=C\C[C@@H](C)C(OC(C)=O)C(C(=O)CC)N(C)C(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC)C(C)C)[13C]([2H])([2H])[2H] |
| InChI | InChI=1S/C26H47N3O5/c1-11-13-14-18(7)24(34-19(8)30)23(21(31)12-2)29(10)26(33)22(17(5)6)28-25(32)20(27-9)15-16(3)4/h11,13,16-18,20,22-24,27H,12,14-15H2,1-10H3,(H,28,32)/b13-11+/t18-,20+,22+,23?,24?/m1/s1/i1+1D3,11+1D |
| InChIKey | GESIXRFFDCRRMZ-WWQFQIBDSA-N |
| XLogP | 3.10 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|