C15H30N2O2 — CID 71315121
(2S)-4-methyl-2-(methylamino)-N-[(3S)-2-methyl-4-oxoheptan-3-yl]pentanamide (PubChem CID 71315121) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (2S)-4-methyl-2-(methylamino)-N-[(3S)-2-methyl-4-oxoheptan-3-yl]pentanamide.
| Compound Name | (2S)-4-methyl-2-(methylamino)-N-[(3S)-2-methyl-4-oxoheptan-3-yl]pentanamide |
|---|---|
| PubChem CID | 71315121 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | (2S)-4-methyl-2-(methylamino)-N-[(3S)-2-methyl-4-oxoheptan-3-yl]pentanamide |
| SMILES | CCCC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC)C(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-7-8-13(18)14(11(4)5)17-15(19)12(16-6)9-10(2)3/h10-12,14,16H,7-9H2,1-6H3,(H,17,19)/t12-,14-/m0/s1 |
| InChIKey | HEVMUOUXCCOQBM-JSGCOSHPSA-N |
| XLogP | 2.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |