C20H39N3O3 — CID 156566910
(2S)-4-methyl-2-(methylamino)-N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxoheptan-2-yl]amino]pentan-2-yl]pentanamide (PubChem CID 156566910) has the molecular formula C20H39N3O3 and a molecular weight of 369.55 g/mol. Its IUPAC name is (2S)-4-methyl-2-(methylamino)-N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxoheptan-2-yl]amino]pentan-2-yl]pentanamide.
| Compound Name | (2S)-4-methyl-2-(methylamino)-N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxoheptan-2-yl]amino]pentan-2-yl]pentanamide |
|---|---|
| PubChem CID | 156566910 |
| Molecular Formula | C20H39N3O3 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.30 |
| IUPAC Name | (2S)-4-methyl-2-(methylamino)-N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxoheptan-2-yl]amino]pentan-2-yl]pentanamide |
| SMILES | CCCCC[C@@H](C=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC |
| InChI | InChI=1S/C20H39N3O3/c1-7-8-9-10-16(13-24)22-20(26)18(12-15(4)5)23-19(25)17(21-6)11-14(2)3/h13-18,21H,7-12H2,1-6H3,(H,22,26)(H,23,25)/t16-,17-,18-/m0/s1 |
| InChIKey | MOVBTMRJBMLYSW-BZSNNMDCSA-N |
| XLogP | 2.42 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|