C20H29ClN2O4 — CID 15021476
(2-chlorophenyl)methyl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxohexan-2-yl]amino]pentan-2-yl]carbamate (PubChem CID 15021476) has the molecular formula C20H29ClN2O4 and a molecular weight of 396.92 g/mol. Its IUPAC name is (2-chlorophenyl)methyl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxohexan-2-yl]amino]pentan-2-yl]carbamate.
| Compound Name | (2-chlorophenyl)methyl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxohexan-2-yl]amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 15021476 |
| Molecular Formula | C20H29ClN2O4 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (2-chlorophenyl)methyl N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxohexan-2-yl]amino]pentan-2-yl]carbamate |
| SMILES | CCCC[C@@H](C=O)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1Cl |
| InChI | InChI=1S/C20H29ClN2O4/c1-4-5-9-16(12-24)22-19(25)18(11-14(2)3)23-20(26)27-13-15-8-6-7-10-17(15)21/h6-8,10,12,14,16,18H,4-5,9,11,13H2,1-3H3,(H,22,25)(H,23,26)/t16-,18-/m0/s1 |
| InChIKey | HCSHBNNKHMMATL-WMZOPIPTSA-N |
| XLogP | 3.85 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|