C24H40ClN3O3 — CID 18654679
(2-chlorophenyl)methyl N-[(2R)-6-amino-1-(dipentylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 18654679) has the molecular formula C24H40ClN3O3 and a molecular weight of 454.06 g/mol. Its IUPAC name is (2-chlorophenyl)methyl N-[(2R)-6-amino-1-(dipentylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | (2-chlorophenyl)methyl N-[(2R)-6-amino-1-(dipentylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 18654679 |
| Molecular Formula | C24H40ClN3O3 |
| Molecular Weight | 454.06 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | (2-chlorophenyl)methyl N-[(2R)-6-amino-1-(dipentylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | CCCCCN(CCCCC)C(=O)[C@@H](CCCCN)NC(=O)OCc1ccccc1Cl |
| InChI | InChI=1S/C24H40ClN3O3/c1-3-5-11-17-28(18-12-6-4-2)23(29)22(15-9-10-16-26)27-24(30)31-19-20-13-7-8-14-21(20)25/h7-8,13-14,22H,3-6,9-12,15-19,26H2,1-2H3,(H,27,30)/t22-/m1/s1 |
| InChIKey | DYLXALVHXHDCQH-JOCHJYFZSA-N |
| XLogP | 5.27 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.06 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|