C29H55N3O4 — CID 71749549
[(E,5R,6R)-5-methyl-7-(methylamino)-8-oxopentadec-2-en-6-yl] (2S)-3-methyl-2-[[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoate (PubChem CID 71749549) has the molecular formula C29H55N3O4 and a molecular weight of 509.78 g/mol. Its IUPAC name is [(E,5R,6R)-5-methyl-7-(methylamino)-8-oxopentadec-2-en-6-yl] (2S)-3-methyl-2-[[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoate.
| Compound Name | [(E,5R,6R)-5-methyl-7-(methylamino)-8-oxopentadec-2-en-6-yl] (2S)-3-methyl-2-[[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoate |
|---|---|
| PubChem CID | 71749549 |
| Molecular Formula | C29H55N3O4 |
| Molecular Weight | 509.78 g/mol |
| Exact Mass | 509.42 |
| IUPAC Name | [(E,5R,6R)-5-methyl-7-(methylamino)-8-oxopentadec-2-en-6-yl] (2S)-3-methyl-2-[[(2S)-4-methyl-2-(methylamino)pentanoyl]amino]butanoate |
| SMILES | C/C=C/C[C@@H](C)[C@@H](OC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC)C(C)C)C(NC)C(=O)CCCCCCC |
| InChI | InChI=1S/C29H55N3O4/c1-10-12-14-15-16-18-24(33)26(31-9)27(22(7)17-13-11-2)36-29(35)25(21(5)6)32-28(34)23(30-8)19-20(3)4/h11,13,20-23,25-27,30-31H,10,12,14-19H2,1-9H3,(H,32,34)/b13-11+/t22-,23+,25+,26?,27-/m1/s1 |
| InChIKey | WPQBWMHHEXUOHJ-HPJRLRKPSA-N |
| XLogP | 4.79 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.78 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|