C13H28N2O — CID 115303265
N-(2-amino-2-methylpropyl)-3,5,5-trimethylhexanamide (PubChem CID 115303265) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-3,5,5-trimethylhexanamide.
| Compound Name | N-(2-amino-2-methylpropyl)-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 115303265 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)NCC(C)(C)N)CC(C)(C)C |
| InChI | InChI=1S/C13H28N2O/c1-10(8-12(2,3)4)7-11(16)15-9-13(5,6)14/h10H,7-9,14H2,1-6H3,(H,15,16) |
| InChIKey | MZLLOKGIVXKXET-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |