About acetonitrile;propan-2-yloxy hydrogen carbonate
acetonitrile;propan-2-yloxy hydrogen carbonate (PubChem CID 88815827) has the molecular formula C6H11NO4
and a molecular weight of 161.16 g/mol. Its IUPAC name is acetonitrile;propan-2-yloxy hydrogen carbonate.
Molecular Properties
| Compound Name | acetonitrile;propan-2-yloxy hydrogen carbonate |
| PubChem CID | 88815827 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | acetonitrile;propan-2-yloxy hydrogen carbonate |
| SMILES | CC#N.CC(C)OOC(=O)O |
| InChI | InChI=1S/C4H8O4.C2H3N/c1-3(2)7-8-4(5)6;1-2-3/h3H,1-2H3,(H,5,6);1H3 |
| InChIKey | SSYMSDBUQDHBSI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;propan-2-yloxy hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;propan-2-yloxy hydrogen carbonate?
The IUPAC name of acetonitrile;propan-2-yloxy hydrogen carbonate (CID 88815827) is acetonitrile;propan-2-yloxy hydrogen carbonate.
What is the SMILES notation for acetonitrile;propan-2-yloxy hydrogen carbonate?
The canonical SMILES for acetonitrile;propan-2-yloxy hydrogen carbonate is CC#N.CC(C)OOC(=O)O.
What is the InChIKey of acetonitrile;propan-2-yloxy hydrogen carbonate?
The InChIKey is SSYMSDBUQDHBSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O4.C2H3N/c1-3(2)7-8-4(5)6;1-2-3/h3H,1-2H3,(H,5,6);1H3.
What are the key properties of acetonitrile;propan-2-yloxy hydrogen carbonate?
acetonitrile;propan-2-yloxy hydrogen carbonate has a molecular weight of 161.16 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;propan-2-yloxy hydrogen carbonate is sourced from PubChem (CID 88815827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).