About acetonitrile;ethenyl hydrogen carbonate
acetonitrile;ethenyl hydrogen carbonate (PubChem CID 174594655) has the molecular formula C5H7NO3
and a molecular weight of 129.11 g/mol. Its IUPAC name is acetonitrile;ethenyl hydrogen carbonate.
Molecular Properties
| Compound Name | acetonitrile;ethenyl hydrogen carbonate |
| PubChem CID | 174594655 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | acetonitrile;ethenyl hydrogen carbonate |
| SMILES | C=COC(=O)O.CC#N |
| InChI | InChI=1S/C3H4O3.C2H3N/c1-2-6-3(4)5;1-2-3/h2H,1H2,(H,4,5);1H3 |
| InChIKey | UXVWZBNZAJBFJU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;ethenyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;ethenyl hydrogen carbonate?
The IUPAC name of acetonitrile;ethenyl hydrogen carbonate (CID 174594655) is acetonitrile;ethenyl hydrogen carbonate.
What is the SMILES notation for acetonitrile;ethenyl hydrogen carbonate?
The canonical SMILES for acetonitrile;ethenyl hydrogen carbonate is C=COC(=O)O.CC#N.
What is the InChIKey of acetonitrile;ethenyl hydrogen carbonate?
The InChIKey is UXVWZBNZAJBFJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O3.C2H3N/c1-2-6-3(4)5;1-2-3/h2H,1H2,(H,4,5);1H3.
What are the key properties of acetonitrile;ethenyl hydrogen carbonate?
acetonitrile;ethenyl hydrogen carbonate has a molecular weight of 129.11 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;ethenyl hydrogen carbonate is sourced from PubChem (CID 174594655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).