About hydroxy 2-methylpropyl carbonate
hydroxy 2-methylpropyl carbonate (PubChem CID 140981524) has the molecular formula C5H10O4
and a molecular weight of 134.13 g/mol. Its IUPAC name is hydroxy 2-methylpropyl carbonate.
Molecular Properties
| Compound Name | hydroxy 2-methylpropyl carbonate |
| PubChem CID | 140981524 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | hydroxy 2-methylpropyl carbonate |
| SMILES | CC(C)COC(=O)OO |
| InChI | InChI=1S/C5H10O4/c1-4(2)3-8-5(6)9-7/h4,7H,3H2,1-2H3 |
| InChIKey | ZKNYXQYURYDTBQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydroxy 2-methylpropyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy 2-methylpropyl carbonate?
The IUPAC name of hydroxy 2-methylpropyl carbonate (CID 140981524) is hydroxy 2-methylpropyl carbonate.
What is the SMILES notation for hydroxy 2-methylpropyl carbonate?
The canonical SMILES for hydroxy 2-methylpropyl carbonate is CC(C)COC(=O)OO.
What is the InChIKey of hydroxy 2-methylpropyl carbonate?
The InChIKey is ZKNYXQYURYDTBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O4/c1-4(2)3-8-5(6)9-7/h4,7H,3H2,1-2H3.
What are the key properties of hydroxy 2-methylpropyl carbonate?
hydroxy 2-methylpropyl carbonate has a molecular weight of 134.13 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy 2-methylpropyl carbonate is sourced from PubChem (CID 140981524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).