About (3,5-ditert-butylphenyl) 2-methylpropyl carbonate
(3,5-ditert-butylphenyl) 2-methylpropyl carbonate (PubChem CID 67162029) has the molecular formula C19H30O3
and a molecular weight of 306.45 g/mol. Its IUPAC name is (3,5-ditert-butylphenyl) 2-methylpropyl carbonate.
Molecular Properties
| Compound Name | (3,5-ditert-butylphenyl) 2-methylpropyl carbonate |
| PubChem CID | 67162029 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (3,5-ditert-butylphenyl) 2-methylpropyl carbonate |
| SMILES | CC(C)COC(=O)Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H30O3/c1-13(2)12-21-17(20)22-16-10-14(18(3,4)5)9-15(11-16)19(6,7)8/h9-11,13H,12H2,1-8H3 |
| InChIKey | ABYKJUWPJFWPIP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (3,5-ditert-butylphenyl) 2-methylpropyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-ditert-butylphenyl) 2-methylpropyl carbonate?
The IUPAC name of (3,5-ditert-butylphenyl) 2-methylpropyl carbonate (CID 67162029) is (3,5-ditert-butylphenyl) 2-methylpropyl carbonate.
What is the SMILES notation for (3,5-ditert-butylphenyl) 2-methylpropyl carbonate?
The canonical SMILES for (3,5-ditert-butylphenyl) 2-methylpropyl carbonate is CC(C)COC(=O)Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1.
What is the InChIKey of (3,5-ditert-butylphenyl) 2-methylpropyl carbonate?
The InChIKey is ABYKJUWPJFWPIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O3/c1-13(2)12-21-17(20)22-16-10-14(18(3,4)5)9-15(11-16)19(6,7)8/h9-11,13H,12H2,1-8H3.
What are the key properties of (3,5-ditert-butylphenyl) 2-methylpropyl carbonate?
(3,5-ditert-butylphenyl) 2-methylpropyl carbonate has a molecular weight of 306.45 g/mol, XLogP of 5.45, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-ditert-butylphenyl) 2-methylpropyl carbonate is sourced from PubChem (CID 67162029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).