C16H20F6O10 — CID 18939188
2,2,2-trifluoroethyl 2-[2,5-dimethyl-5-[2-oxo-2-(2,2,2-trifluoroethoxy)acetyl]peroxyhexan-2-yl]peroxy-2-oxoacetate (PubChem CID 18939188) has the molecular formula C16H20F6O10 and a molecular weight of 486.31 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[2,5-dimethyl-5-[2-oxo-2-(2,2,2-trifluoroethoxy)acetyl]peroxyhexan-2-yl]peroxy-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[2,5-dimethyl-5-[2-oxo-2-(2,2,2-trifluoroethoxy)acetyl]peroxyhexan-2-yl]peroxy-2-oxoacetate |
|---|---|
| PubChem CID | 18939188 |
| Molecular Formula | C16H20F6O10 |
| Molecular Weight | 486.31 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[2,5-dimethyl-5-[2-oxo-2-(2,2,2-trifluoroethoxy)acetyl]peroxyhexan-2-yl]peroxy-2-oxoacetate |
| SMILES | CC(C)(CCC(C)(C)OOC(=O)C(=O)OCC(F)(F)F)OOC(=O)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C16H20F6O10/c1-13(2,31-29-11(25)9(23)27-7-15(17,18)19)5-6-14(3,4)32-30-12(26)10(24)28-8-16(20,21)22/h5-8H2,1-4H3 |
| InChIKey | CMAYRIPGTWIYDM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|