C25H50O6 — CID 21289255
butyl 4,4-bis(2,4,4-trimethylpentan-2-ylperoxy)pentanoate (PubChem CID 21289255) has the molecular formula C25H50O6 and a molecular weight of 446.67 g/mol. Its IUPAC name is butyl 4,4-bis(2,4,4-trimethylpentan-2-ylperoxy)pentanoate.
| Compound Name | butyl 4,4-bis(2,4,4-trimethylpentan-2-ylperoxy)pentanoate |
|---|---|
| PubChem CID | 21289255 |
| Molecular Formula | C25H50O6 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | butyl 4,4-bis(2,4,4-trimethylpentan-2-ylperoxy)pentanoate |
| SMILES | CCCCOC(=O)CCC(C)(OOC(C)(C)CC(C)(C)C)OOC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C25H50O6/c1-13-14-17-27-20(26)15-16-25(12,30-28-23(8,9)18-21(2,3)4)31-29-24(10,11)19-22(5,6)7/h13-19H2,1-12H3 |
| InChIKey | BITHCWOJNDLUOU-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|