C36H64O12 — CID 88613863
butyl 4,4-bis(tert-butylperoxy)pentanoate;phenyl 4,4-bis(tert-butylperoxy)pentanoate (PubChem CID 88613863) has the molecular formula C36H64O12 and a molecular weight of 688.90 g/mol. Its IUPAC name is butyl 4,4-bis(tert-butylperoxy)pentanoate;phenyl 4,4-bis(tert-butylperoxy)pentanoate.
| Compound Name | butyl 4,4-bis(tert-butylperoxy)pentanoate;phenyl 4,4-bis(tert-butylperoxy)pentanoate |
|---|---|
| PubChem CID | 88613863 |
| Molecular Formula | C36H64O12 |
| Molecular Weight | 688.90 g/mol |
| Exact Mass | 688.44 |
| IUPAC Name | butyl 4,4-bis(tert-butylperoxy)pentanoate;phenyl 4,4-bis(tert-butylperoxy)pentanoate |
| SMILES | CC(C)(C)OOC(C)(CCC(=O)Oc1ccccc1)OOC(C)(C)C.CCCCOC(=O)CCC(C)(OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C19H30O6.C17H34O6/c1-17(2,3)22-24-19(7,25-23-18(4,5)6)14-13-16(20)21-15-11-9-8-10-12-15;1-9-10-13-19-14(18)11-12-17(8,22-20-15(2,3)4)23-21-16(5,6)7/h8-12H,13-14H2,1-7H3;9-13H2,1-8H3 |
| InChIKey | GUKGLFCWTKBCNF-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.90 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|