C19H38O6 — CID 23506147
butyl 4,4-bis(2-methylbutan-2-ylperoxy)pentanoate (PubChem CID 23506147) has the molecular formula C19H38O6 and a molecular weight of 362.51 g/mol. Its IUPAC name is butyl 4,4-bis(2-methylbutan-2-ylperoxy)pentanoate.
| Compound Name | butyl 4,4-bis(2-methylbutan-2-ylperoxy)pentanoate |
|---|---|
| PubChem CID | 23506147 |
| Molecular Formula | C19H38O6 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | butyl 4,4-bis(2-methylbutan-2-ylperoxy)pentanoate |
| SMILES | CCCCOC(=O)CCC(C)(OOC(C)(C)CC)OOC(C)(C)CC |
| InChI | InChI=1S/C19H38O6/c1-9-12-15-21-16(20)13-14-19(8,24-22-17(4,5)10-2)25-23-18(6,7)11-3/h9-15H2,1-8H3 |
| InChIKey | PAKRLBFYNABWNT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|