C17H32F2O6 — CID 154927897
butyl 4,4-bis(1-fluorobutylperoxy)pentanoate (PubChem CID 154927897) has the molecular formula C17H32F2O6 and a molecular weight of 370.43 g/mol. Its IUPAC name is butyl 4,4-bis(1-fluorobutylperoxy)pentanoate.
| Compound Name | butyl 4,4-bis(1-fluorobutylperoxy)pentanoate |
|---|---|
| PubChem CID | 154927897 |
| Molecular Formula | C17H32F2O6 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | butyl 4,4-bis(1-fluorobutylperoxy)pentanoate |
| SMILES | CCCCOC(=O)CCC(C)(OOC(F)CCC)OOC(F)CCC |
| InChI | InChI=1S/C17H32F2O6/c1-5-8-13-21-16(20)11-12-17(4,24-22-14(18)9-6-2)25-23-15(19)10-7-3/h14-15H,5-13H2,1-4H3 |
| InChIKey | WGESYGAJEKDULE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|