C30H60O11 — CID 175971829
butyl 4,4-bis(tert-butylperoxy)pentanoate;(1-tert-butylperoxy-2-ethylhexyl) hydrogen carbonate (PubChem CID 175971829) has the molecular formula C30H60O11 and a molecular weight of 596.80 g/mol. Its IUPAC name is butyl 4,4-bis(tert-butylperoxy)pentanoate;(1-tert-butylperoxy-2-ethylhexyl) hydrogen carbonate.
| Compound Name | butyl 4,4-bis(tert-butylperoxy)pentanoate;(1-tert-butylperoxy-2-ethylhexyl) hydrogen carbonate |
|---|---|
| PubChem CID | 175971829 |
| Molecular Formula | C30H60O11 |
| Molecular Weight | 596.80 g/mol |
| Exact Mass | 596.41 |
| IUPAC Name | butyl 4,4-bis(tert-butylperoxy)pentanoate;(1-tert-butylperoxy-2-ethylhexyl) hydrogen carbonate |
| SMILES | CCCCC(CC)C(OOC(C)(C)C)OC(=O)O.CCCCOC(=O)CCC(C)(OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C17H34O6.C13H26O5/c1-9-10-13-19-14(18)11-12-17(8,22-20-15(2,3)4)23-21-16(5,6)7;1-6-8-9-10(7-2)11(16-12(14)15)17-18-13(3,4)5/h9-13H2,1-8H3;10-11H,6-9H2,1-5H3,(H,14,15) |
| InChIKey | HRYWULCMJLVOBT-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.80 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|