C13H24O4 — CID 91717917
1-O-butyl 3-O-(3,3-dimethylbutan-2-yl) propanedioate (PubChem CID 91717917) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-O-butyl 3-O-(3,3-dimethylbutan-2-yl) propanedioate.
| Compound Name | 1-O-butyl 3-O-(3,3-dimethylbutan-2-yl) propanedioate |
|---|---|
| PubChem CID | 91717917 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 1-O-butyl 3-O-(3,3-dimethylbutan-2-yl) propanedioate |
| SMILES | CCCCOC(=O)CC(=O)OC(C)C(C)(C)C |
| InChI | InChI=1S/C13H24O4/c1-6-7-8-16-11(14)9-12(15)17-10(2)13(3,4)5/h10H,6-9H2,1-5H3 |
| InChIKey | XSAYKAGGMXLSRU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|