C16H35NO2 — CID 167513215
propanamide;2,2,4-trimethyl-4-(3-methylbutoxy)pentane (PubChem CID 167513215) has the molecular formula C16H35NO2 and a molecular weight of 273.46 g/mol. Its IUPAC name is propanamide;2,2,4-trimethyl-4-(3-methylbutoxy)pentane.
| Compound Name | propanamide;2,2,4-trimethyl-4-(3-methylbutoxy)pentane |
|---|---|
| PubChem CID | 167513215 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.27 |
| IUPAC Name | propanamide;2,2,4-trimethyl-4-(3-methylbutoxy)pentane |
| SMILES | CC(C)CCOC(C)(C)CC(C)(C)C.CCC(N)=O |
| InChI | InChI=1S/C13H28O.C3H7NO/c1-11(2)8-9-14-13(6,7)10-12(3,4)5;1-2-3(4)5/h11H,8-10H2,1-7H3;2H2,1H3,(H2,4,5) |
| InChIKey | ZNXXSMXHLBUINX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |