About 2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide
2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide (PubChem CID 171804821) has the molecular formula C21H41NO4
and a molecular weight of 371.56 g/mol. Its IUPAC name is 2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide.
Molecular Properties
| Compound Name | 2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide |
| PubChem CID | 171804821 |
| Molecular Formula | C21H41NO4 |
| Molecular Weight | 371.56 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | 2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide |
| SMILES | CC(C)C(=O)CCCC(N)=O.CC(C)CCOC(C)(C)CC(=O)C(C)C |
| InChI | InChI=1S/C13H26O2.C8H15NO2/c1-10(2)7-8-15-13(5,6)9-12(14)11(3)4;1-6(2)7(10)4-3-5-8(9)11/h10-11H,7-9H2,1-6H3;6H,3-5H2,1-2H3,(H2,9,11) |
| InChIKey | RSCIJWZIBZXYFW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide?
The IUPAC name of 2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide (CID 171804821) is 2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide.
What is the SMILES notation for 2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide?
The canonical SMILES for 2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide is CC(C)C(=O)CCCC(N)=O.CC(C)CCOC(C)(C)CC(=O)C(C)C.
What is the InChIKey of 2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide?
The InChIKey is RSCIJWZIBZXYFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2.C8H15NO2/c1-10(2)7-8-15-13(5,6)9-12(14)11(3)4;1-6(2)7(10)4-3-5-8(9)11/h10-11H,7-9H2,1-6H3;6H,3-5H2,1-2H3,(H2,9,11).
What are the key properties of 2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide?
2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide has a molecular weight of 371.56 g/mol, XLogP of 4.31, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-5-(3-methylbutoxy)hexan-3-one;6-methyl-5-oxoheptanamide is sourced from PubChem (CID 171804821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).