C23H43N3O5 — CID 164603096
3-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)propanamide;3-methyl-3-(3-methylbutoxy)-N-propan-2-ylbutanamide (PubChem CID 164603096) has the molecular formula C23H43N3O5 and a molecular weight of 441.61 g/mol. Its IUPAC name is 3-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)propanamide;3-methyl-3-(3-methylbutoxy)-N-propan-2-ylbutanamide.
| Compound Name | 3-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)propanamide;3-methyl-3-(3-methylbutoxy)-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 164603096 |
| Molecular Formula | C23H43N3O5 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | 3-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)propanamide;3-methyl-3-(3-methylbutoxy)-N-propan-2-ylbutanamide |
| SMILES | CC(C)C1CC(=O)N(CCC(N)=O)C1=O.CC(C)CCOC(C)(C)CC(=O)NC(C)C |
| InChI | InChI=1S/C13H27NO2.C10H16N2O3/c1-10(2)7-8-16-13(5,6)9-12(15)14-11(3)4;1-6(2)7-5-9(14)12(10(7)15)4-3-8(11)13/h10-11H,7-9H2,1-6H3,(H,14,15);6-7H,3-5H2,1-2H3,(H2,11,13) |
| InChIKey | NXHLBAIGFLQSMM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|