C15H33NO3 — CID 164574575
ethane;4-(3-methyl-3-propoxybutoxy)pentanamide (PubChem CID 164574575) has the molecular formula C15H33NO3 and a molecular weight of 275.43 g/mol. Its IUPAC name is ethane;4-(3-methyl-3-propoxybutoxy)pentanamide.
| Compound Name | ethane;4-(3-methyl-3-propoxybutoxy)pentanamide |
|---|---|
| PubChem CID | 164574575 |
| Molecular Formula | C15H33NO3 |
| Molecular Weight | 275.43 g/mol |
| Exact Mass | 275.25 |
| IUPAC Name | ethane;4-(3-methyl-3-propoxybutoxy)pentanamide |
| SMILES | CC.CCCOC(C)(C)CCOC(C)CCC(N)=O |
| InChI | InChI=1S/C13H27NO3.C2H6/c1-5-9-17-13(3,4)8-10-16-11(2)6-7-12(14)15;1-2/h11H,5-10H2,1-4H3,(H2,14,15);1-2H3 |
| InChIKey | ZHVVEEQVWABFBR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |