About 4-propoxypentanimidamide
4-propoxypentanimidamide (PubChem CID 158121909) has the molecular formula C8H18N2O
and a molecular weight of 158.25 g/mol. Its IUPAC name is 4-propoxypentanimidamide.
Molecular Properties
| Compound Name | 4-propoxypentanimidamide |
| PubChem CID | 158121909 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 4-propoxypentanimidamide |
| SMILES | [H]/N=C(\N)CCC(C)OCCC |
| InChI | InChI=1S/C8H18N2O/c1-3-6-11-7(2)4-5-8(9)10/h7H,3-6H2,1-2H3,(H3,9,10) |
| InChIKey | VEWOADQYEIWRHA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-propoxypentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propoxypentanimidamide?
The IUPAC name of 4-propoxypentanimidamide (CID 158121909) is 4-propoxypentanimidamide.
What is the SMILES notation for 4-propoxypentanimidamide?
The canonical SMILES for 4-propoxypentanimidamide is [H]/N=C(\N)CCC(C)OCCC.
What is the InChIKey of 4-propoxypentanimidamide?
The InChIKey is VEWOADQYEIWRHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-3-6-11-7(2)4-5-8(9)10/h7H,3-6H2,1-2H3,(H3,9,10).
What are the key properties of 4-propoxypentanimidamide?
4-propoxypentanimidamide has a molecular weight of 158.25 g/mol, XLogP of 1.52, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propoxypentanimidamide is sourced from PubChem (CID 158121909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).