About 5-methyloctanimidamide
5-methyloctanimidamide (PubChem CID 54213893) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 5-methyloctanimidamide.
Molecular Properties
| Compound Name | 5-methyloctanimidamide |
| PubChem CID | 54213893 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 5-methyloctanimidamide |
| SMILES | [H]/N=C(\N)CCCC(C)CCC |
| InChI | InChI=1S/C9H20N2/c1-3-5-8(2)6-4-7-9(10)11/h8H,3-7H2,1-2H3,(H3,10,11) |
| InChIKey | QFMDATWPWSTNPW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-methyloctanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyloctanimidamide?
The IUPAC name of 5-methyloctanimidamide (CID 54213893) is 5-methyloctanimidamide.
What is the SMILES notation for 5-methyloctanimidamide?
The canonical SMILES for 5-methyloctanimidamide is [H]/N=C(\N)CCCC(C)CCC.
What is the InChIKey of 5-methyloctanimidamide?
The InChIKey is QFMDATWPWSTNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2/c1-3-5-8(2)6-4-7-9(10)11/h8H,3-7H2,1-2H3,(H3,10,11).
What are the key properties of 5-methyloctanimidamide?
5-methyloctanimidamide has a molecular weight of 156.27 g/mol, XLogP of 2.53, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyloctanimidamide is sourced from PubChem (CID 54213893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).